C15H14BrN5OS2 — CID 55884605
2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide (PubChem CID 55884605) has the molecular formula C15H14BrN5OS2 and a molecular weight of 424.35 g/mol. Its IUPAC name is 2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide.
| Compound Name | 2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 55884605 |
| Molecular Formula | C15H14BrN5OS2 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | 2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide |
| SMILES | O=C(Cc1csc(-c2cc(Br)cs2)n1)NCCNc1ncccn1 |
| InChI | InChI=1S/C15H14BrN5OS2/c16-10-6-12(23-8-10)14-21-11(9-24-14)7-13(22)17-4-5-20-15-18-2-1-3-19-15/h1-3,6,8-9H,4-5,7H2,(H,17,22)(H,18,19,20) |
| InChIKey | IWFLIQRDTCSBOJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|