C16H11BrClN3O3S2 — CID 55855781
N'-[2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]-5-chloro-2-hydroxybenzohydrazide (PubChem CID 55855781) has the molecular formula C16H11BrClN3O3S2 and a molecular weight of 472.77 g/mol. Its IUPAC name is N'-[2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]-5-chloro-2-hydroxybenzohydrazide.
| Compound Name | N'-[2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]-5-chloro-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 55855781 |
| Molecular Formula | C16H11BrClN3O3S2 |
| Molecular Weight | 472.77 g/mol |
| Exact Mass | 470.91 |
| IUPAC Name | N'-[2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]-5-chloro-2-hydroxybenzohydrazide |
| SMILES | O=C(Cc1csc(-c2cc(Br)cs2)n1)NNC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H11BrClN3O3S2/c17-8-3-13(25-6-8)16-19-10(7-26-16)5-14(23)20-21-15(24)11-4-9(18)1-2-12(11)22/h1-4,6-7,22H,5H2,(H,20,23)(H,21,24) |
| InChIKey | RGARRNOYWSBCOY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|