C12H12BrN3OS — CID 108748929
3-bromo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propanamide (PubChem CID 108748929) has the molecular formula C12H12BrN3OS and a molecular weight of 326.22 g/mol. Its IUPAC name is 3-bromo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propanamide.
| Compound Name | 3-bromo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 108748929 |
| Molecular Formula | C12H12BrN3OS |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 3-bromo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propanamide |
| SMILES | O=C(CCBr)NCc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C12H12BrN3OS/c13-5-4-11(17)15-7-9-8-18-12(16-9)10-3-1-2-6-14-10/h1-3,6,8H,4-5,7H2,(H,15,17) |
| InChIKey | DLTORBIBQSSKAH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|