C16H12FN3OS — CID 108748855
3-fluoro-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 108748855) has the molecular formula C16H12FN3OS and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-fluoro-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 3-fluoro-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 108748855 |
| Molecular Formula | C16H12FN3OS |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-fluoro-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1csc(-c2ccccn2)n1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H12FN3OS/c17-12-5-3-4-11(8-12)15(21)19-9-13-10-22-16(20-13)14-6-1-2-7-18-14/h1-8,10H,9H2,(H,19,21) |
| InChIKey | QLFOASKPOKTWEB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |