C24H19N3OS — CID 108770782
(Z)-2,3-diphenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]prop-2-enamide (PubChem CID 108770782) has the molecular formula C24H19N3OS and a molecular weight of 397.50 g/mol. Its IUPAC name is (Z)-2,3-diphenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (Z)-2,3-diphenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 108770782 |
| Molecular Formula | C24H19N3OS |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (Z)-2,3-diphenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
| SMILES | O=C(NCc1csc(-c2ccccn2)n1)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19N3OS/c28-23(26-16-20-17-29-24(27-20)22-13-7-8-14-25-22)21(19-11-5-2-6-12-19)15-18-9-3-1-4-10-18/h1-15,17H,16H2,(H,26,28)/b21-15- |
| InChIKey | DVFQVNRDEVZTGY-QNGOZBTKSA-N |
| XLogP | 5.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|