C14H15N3O2S — CID 108748806
N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]oxolane-2-carboxamide (PubChem CID 108748806) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]oxolane-2-carboxamide.
| Compound Name | N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 108748806 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]oxolane-2-carboxamide |
| SMILES | O=C(NCc1csc(-c2ccccn2)n1)C1CCCO1 |
| InChI | InChI=1S/C14H15N3O2S/c18-13(12-5-3-7-19-12)16-8-10-9-20-14(17-10)11-4-1-2-6-15-11/h1-2,4,6,9,12H,3,5,7-8H2,(H,16,18) |
| InChIKey | IVJXKOGWFZYFHH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |