C16H20N4OS — CID 108784317
1-cyclohexyl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]urea (PubChem CID 108784317) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]urea.
| Compound Name | 1-cyclohexyl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 108784317 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-cyclohexyl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]urea |
| SMILES | O=C(NCc1csc(-c2ccccn2)n1)NC1CCCCC1 |
| InChI | InChI=1S/C16H20N4OS/c21-16(20-12-6-2-1-3-7-12)18-10-13-11-22-15(19-13)14-8-4-5-9-17-14/h4-5,8-9,11-12H,1-3,6-7,10H2,(H2,18,20,21) |
| InChIKey | XPENZQDBLPYLRH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |