C10H16N4OS — CID 110747812
1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-cyclopentylurea (PubChem CID 110747812) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-cyclopentylurea.
| Compound Name | 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 110747812 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-cyclopentylurea |
| SMILES | Nc1nc(CNC(=O)NC2CCCC2)cs1 |
| InChI | InChI=1S/C10H16N4OS/c11-9-13-8(6-16-9)5-12-10(15)14-7-3-1-2-4-7/h6-7H,1-5H2,(H2,11,13)(H2,12,14,15) |
| InChIKey | NDGWMNRUPSIDAV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |