C12H19N3OS — CID 55116012
2-amino-N-cyclooctyl-1,3-thiazole-4-carboxamide (PubChem CID 55116012) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-amino-N-cyclooctyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-cyclooctyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55116012 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-amino-N-cyclooctyl-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)NC2CCCCCCC2)cs1 |
| InChI | InChI=1S/C12H19N3OS/c13-12-15-10(8-17-12)11(16)14-9-6-4-2-1-3-5-7-9/h8-9H,1-7H2,(H2,13,15)(H,14,16) |
| InChIKey | VDFBELMGJLWTEG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |