C13H19N3O2S — CID 53158336
4-N-cyclohexyl-2-N-ethyl-1,3-thiazole-2,4-dicarboxamide (PubChem CID 53158336) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-ethyl-1,3-thiazole-2,4-dicarboxamide.
| Compound Name | 4-N-cyclohexyl-2-N-ethyl-1,3-thiazole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 53158336 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-N-cyclohexyl-2-N-ethyl-1,3-thiazole-2,4-dicarboxamide |
| SMILES | CCNC(=O)c1nc(C(=O)NC2CCCCC2)cs1 |
| InChI | InChI=1S/C13H19N3O2S/c1-2-14-12(18)13-16-10(8-19-13)11(17)15-9-6-4-3-5-7-9/h8-9H,2-7H2,1H3,(H,14,18)(H,15,17) |
| InChIKey | WLSZFMRQGKVHNF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |