C12H17N3O2S — CID 53158448
2-N-cyclopropyl-4-N,4-N-diethyl-1,3-thiazole-2,4-dicarboxamide (PubChem CID 53158448) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-N-cyclopropyl-4-N,4-N-diethyl-1,3-thiazole-2,4-dicarboxamide.
| Compound Name | 2-N-cyclopropyl-4-N,4-N-diethyl-1,3-thiazole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 53158448 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-N-cyclopropyl-4-N,4-N-diethyl-1,3-thiazole-2,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1csc(C(=O)NC2CC2)n1 |
| InChI | InChI=1S/C12H17N3O2S/c1-3-15(4-2)12(17)9-7-18-11(14-9)10(16)13-8-5-6-8/h7-8H,3-6H2,1-2H3,(H,13,16) |
| InChIKey | RBYLPUOZTSPMLB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |