C15H22N2O3S — CID 116697832
ethyl 4-[(4-ethylcyclohexyl)carbamoyl]-1,3-thiazole-2-carboxylate (PubChem CID 116697832) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is ethyl 4-[(4-ethylcyclohexyl)carbamoyl]-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-[(4-ethylcyclohexyl)carbamoyl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 116697832 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | ethyl 4-[(4-ethylcyclohexyl)carbamoyl]-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)NC2CCC(CC)CC2)cs1 |
| InChI | InChI=1S/C15H22N2O3S/c1-3-10-5-7-11(8-6-10)16-13(18)12-9-21-14(17-12)15(19)20-4-2/h9-11H,3-8H2,1-2H3,(H,16,18) |
| InChIKey | NWOPHTAFKMFZBI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |