C16H25N3OS — CID 3698377
N-cyclooctyl-2-pyrrolidin-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 3698377) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is N-cyclooctyl-2-pyrrolidin-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-cyclooctyl-2-pyrrolidin-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3698377 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-cyclooctyl-2-pyrrolidin-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)c1csc(C2CCCN2)n1 |
| InChI | InChI=1S/C16H25N3OS/c20-15(18-12-7-4-2-1-3-5-8-12)14-11-21-16(19-14)13-9-6-10-17-13/h11-13,17H,1-10H2,(H,18,20) |
| InChIKey | FYONMAHYCJNGGW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |