C10H14N2O2S — CID 40611193
ethyl 2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate (PubChem CID 40611193) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is ethyl 2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 40611193 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | ethyl 2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc([C@H]2CCCN2)n1 |
| InChI | InChI=1S/C10H14N2O2S/c1-2-14-10(13)8-6-15-9(12-8)7-4-3-5-11-7/h6-7,11H,2-5H2,1H3/t7-/m1/s1 |
| InChIKey | UKHLURZCGAUBCQ-SSDOTTSWSA-N |
| XLogP | 1.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |