C12H16N2O3S — CID 174443710
ethyl 2-[(4S)-4-acetylpyrrolidin-2-yl]-1,3-thiazole-4-carboxylate (PubChem CID 174443710) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is ethyl 2-[(4S)-4-acetylpyrrolidin-2-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(4S)-4-acetylpyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 174443710 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | ethyl 2-[(4S)-4-acetylpyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C2C[C@H](C(C)=O)CN2)n1 |
| InChI | InChI=1S/C12H16N2O3S/c1-3-17-12(16)10-6-18-11(14-10)9-4-8(5-13-9)7(2)15/h6,8-9,13H,3-5H2,1-2H3/t8-,9?/m0/s1 |
| InChIKey | LYBXDMQZQJMGCY-IENPIDJESA-N |
| XLogP | 1.56 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |