C12H18N2O2S — CID 80568096
ethyl 2-(azepan-1-yl)-1,3-thiazole-4-carboxylate (PubChem CID 80568096) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is ethyl 2-(azepan-1-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(azepan-1-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 80568096 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | ethyl 2-(azepan-1-yl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C12H18N2O2S/c1-2-16-11(15)10-9-17-12(13-10)14-7-5-3-4-6-8-14/h9H,2-8H2,1H3 |
| InChIKey | FYUJLSYRLVKZQX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |