C8H11N3OS — CID 131092459
2-pyrrolidin-1-yl-1,3-thiazole-4-carboxamide (PubChem CID 131092459) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-pyrrolidin-1-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 131092459 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-pyrrolidin-1-yl-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(N2CCCC2)n1 |
| InChI | InChI=1S/C8H11N3OS/c9-7(12)6-5-13-8(10-6)11-3-1-2-4-11/h5H,1-4H2,(H2,9,12) |
| InChIKey | NEUHOILBFAKOGG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |