C11H15N3O2S2 — CID 22242732
S-[1-(4-carbamoyl-1,3-thiazol-2-yl)piperidin-4-yl] ethanethioate (PubChem CID 22242732) has the molecular formula C11H15N3O2S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is S-[1-(4-carbamoyl-1,3-thiazol-2-yl)piperidin-4-yl] ethanethioate.
| Compound Name | S-[1-(4-carbamoyl-1,3-thiazol-2-yl)piperidin-4-yl] ethanethioate |
|---|---|
| PubChem CID | 22242732 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | S-[1-(4-carbamoyl-1,3-thiazol-2-yl)piperidin-4-yl] ethanethioate |
| SMILES | CC(=O)SC1CCN(c2nc(C(N)=O)cs2)CC1 |
| InChI | InChI=1S/C11H15N3O2S2/c1-7(15)18-8-2-4-14(5-3-8)11-13-9(6-17-11)10(12)16/h6,8H,2-5H2,1H3,(H2,12,16) |
| InChIKey | ADTBHIQBFGLFNQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|