C9H13N3O4S2 — CID 22242894
[1-(4-carbamoyl-1,3-thiazol-2-yl)pyrrolidin-3-yl] methanesulfonate (PubChem CID 22242894) has the molecular formula C9H13N3O4S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is [1-(4-carbamoyl-1,3-thiazol-2-yl)pyrrolidin-3-yl] methanesulfonate.
| Compound Name | [1-(4-carbamoyl-1,3-thiazol-2-yl)pyrrolidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 22242894 |
| Molecular Formula | C9H13N3O4S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | [1-(4-carbamoyl-1,3-thiazol-2-yl)pyrrolidin-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCN(c2nc(C(N)=O)cs2)C1 |
| InChI | InChI=1S/C9H13N3O4S2/c1-18(14,15)16-6-2-3-12(4-6)9-11-7(5-17-9)8(10)13/h5-6H,2-4H2,1H3,(H2,10,13) |
| InChIKey | QSUHNQVFQYJUDY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|