C11H15N3O4S2 — CID 87884737
[1-[4-(azetidine-1-carbonyl)-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate (PubChem CID 87884737) has the molecular formula C11H15N3O4S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is [1-[4-(azetidine-1-carbonyl)-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate.
| Compound Name | [1-[4-(azetidine-1-carbonyl)-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 87884737 |
| Molecular Formula | C11H15N3O4S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [1-[4-(azetidine-1-carbonyl)-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CN(c2nc(C(=O)N3CCC3)cs2)C1 |
| InChI | InChI=1S/C11H15N3O4S2/c1-20(16,17)18-8-5-14(6-8)11-12-9(7-19-11)10(15)13-3-2-4-13/h7-8H,2-6H2,1H3 |
| InChIKey | LRMZMSDPRCJAKW-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|