C21H28N4O2S — CID 53161058
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-thiazol-4-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 53161058) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-thiazol-4-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-thiazol-4-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 53161058 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-thiazol-4-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | COc1ccc(N2CCN(c3nc(C(=O)N4CCC(C)CC4)cs3)CC2)cc1 |
| InChI | InChI=1S/C21H28N4O2S/c1-16-7-9-24(10-8-16)20(26)19-15-28-21(22-19)25-13-11-23(12-14-25)17-3-5-18(27-2)6-4-17/h3-6,15-16H,7-14H2,1-2H3 |
| InChIKey | COFNYPWXUXLPPM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|