C21H26N4O2 — CID 109203696
[4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridinyl]-pyrrolidin-1-ylmethanone (PubChem CID 109203696) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is [4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridinyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridinyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 109203696 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | [4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridinyl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1ccc(N2CCN(c3ccnc(C(=O)N4CCCC4)c3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O2/c1-27-19-6-4-17(5-7-19)23-12-14-24(15-13-23)18-8-9-22-20(16-18)21(26)25-10-2-3-11-25/h4-9,16H,2-3,10-15H2,1H3 |
| InChIKey | CBNATEYZFAILPJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|