C18H28N4O — CID 109208613
azepan-1-yl-[4-(4-ethylpiperazin-1-yl)-2-pyridinyl]methanone (PubChem CID 109208613) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is azepan-1-yl-[4-(4-ethylpiperazin-1-yl)-2-pyridinyl]methanone.
| Compound Name | azepan-1-yl-[4-(4-ethylpiperazin-1-yl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109208613 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | azepan-1-yl-[4-(4-ethylpiperazin-1-yl)-2-pyridinyl]methanone |
| SMILES | CCN1CCN(c2ccnc(C(=O)N3CCCCCC3)c2)CC1 |
| InChI | InChI=1S/C18H28N4O/c1-2-20-11-13-21(14-12-20)16-7-8-19-17(15-16)18(23)22-9-5-3-4-6-10-22/h7-8,15H,2-6,9-14H2,1H3 |
| InChIKey | RPDRGDNYZLDQKQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |