C16H18N4O3 — CID 137147289
4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1H-pyrimidin-6-one (PubChem CID 137147289) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137147289 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1H-pyrimidin-6-one |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc(=O)[nH]cn3)CC2)cc1 |
| InChI | InChI=1S/C16H18N4O3/c1-23-13-4-2-12(3-5-13)19-6-8-20(9-7-19)16(22)14-10-15(21)18-11-17-14/h2-5,10-11H,6-9H2,1H3,(H,17,18,21) |
| InChIKey | LURAMCHMEPHEBV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|