C22H23FN4O2S — CID 53161039
N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide (PubChem CID 53161039) has the molecular formula C22H23FN4O2S and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 53161039 |
| Molecular Formula | C22H23FN4O2S |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(N2CCN(c3nc(C(=O)NCc4ccc(F)cc4)cs3)CC2)cc1 |
| InChI | InChI=1S/C22H23FN4O2S/c1-29-19-8-6-18(7-9-19)26-10-12-27(13-11-26)22-25-20(15-30-22)21(28)24-14-16-2-4-17(23)5-3-16/h2-9,15H,10-14H2,1H3,(H,24,28) |
| InChIKey | RBQAOTBHQJYYNA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|