C23H26FN5OS — CID 71840289
N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide (PubChem CID 71840289) has the molecular formula C23H26FN5OS and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71840289 |
| Molecular Formula | C23H26FN5OS |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2csc(N3CCN(c4ccccc4F)CC3)n2)cc1 |
| InChI | InChI=1S/C23H26FN5OS/c1-27(2)18-9-7-17(8-10-18)15-25-22(30)20-16-31-23(26-20)29-13-11-28(12-14-29)21-6-4-3-5-19(21)24/h3-10,16H,11-15H2,1-2H3,(H,25,30) |
| InChIKey | QWKSPLGALFQHLE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|