C21H25N5O8S2 — CID 90711972
[1-[4-[(4-nitrophenyl)methoxycarbonyl-piperidin-4-ylcarbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate (PubChem CID 90711972) has the molecular formula C21H25N5O8S2 and a molecular weight of 539.59 g/mol. Its IUPAC name is [1-[4-[(4-nitrophenyl)methoxycarbonyl-piperidin-4-ylcarbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate.
| Compound Name | [1-[4-[(4-nitrophenyl)methoxycarbonyl-piperidin-4-ylcarbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 90711972 |
| Molecular Formula | C21H25N5O8S2 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | [1-[4-[(4-nitrophenyl)methoxycarbonyl-piperidin-4-ylcarbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CN(c2nc(C(=O)N(C(=O)OCc3ccc([N+](=O)[O-])cc3)C3CCNCC3)cs2)C1 |
| InChI | InChI=1S/C21H25N5O8S2/c1-36(31,32)34-17-10-24(11-17)20-23-18(13-35-20)19(27)25(15-6-8-22-9-7-15)21(28)33-12-14-2-4-16(5-3-14)26(29)30/h2-5,13,15,17,22H,6-12H2,1H3 |
| InChIKey | SCUCSXDEVMKRNQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 161.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|