C15H20N4O5 — CID 67589286
(4-nitrophenyl)methyl N-(2-amino-2-oxoethyl)-N-[[(3S)-pyrrolidin-3-yl]methyl]carbamate (PubChem CID 67589286) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-(2-amino-2-oxoethyl)-N-[[(3S)-pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-(2-amino-2-oxoethyl)-N-[[(3S)-pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 67589286 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (4-nitrophenyl)methyl N-(2-amino-2-oxoethyl)-N-[[(3S)-pyrrolidin-3-yl]methyl]carbamate |
| SMILES | NC(=O)CN(C[C@H]1CCNC1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H20N4O5/c16-14(20)9-18(8-12-5-6-17-7-12)15(21)24-10-11-1-3-13(4-2-11)19(22)23/h1-4,12,17H,5-10H2,(H2,16,20)/t12-/m0/s1 |
| InChIKey | MZGMPPSSVKYANV-LBPRGKRZSA-N |
| XLogP | 0.63 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|