About (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate
(4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate (PubChem CID 22631864) has the molecular formula C10H10IN3O5
and a molecular weight of 379.11 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate |
| PubChem CID | 22631864 |
| Molecular Formula | C10H10IN3O5 |
| Molecular Weight | 379.11 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate |
| SMILES | NN(C(=O)CI)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H10IN3O5/c11-5-9(15)13(12)10(16)19-6-7-1-3-8(4-2-7)14(17)18/h1-4H,5-6,12H2 |
| InChIKey | OZQHANRRTFUXBD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.11 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate?
The IUPAC name of (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate (CID 22631864) is (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate.
What is the SMILES notation for (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate?
The canonical SMILES for (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate is NN(C(=O)CI)C(=O)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate?
The InChIKey is OZQHANRRTFUXBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10IN3O5/c11-5-9(15)13(12)10(16)19-6-7-1-3-8(4-2-7)14(17)18/h1-4H,5-6,12H2.
What are the key properties of (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate?
(4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate has a molecular weight of 379.11 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl N-amino-N-(2-iodoacetyl)carbamate is sourced from PubChem (CID 22631864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).