C17H24N6O5S — CID 173303591
(4-nitrophenyl)methyl N-[N'-[1-[[(3S)-pyrrolidine-3-carbonyl]amino]-1-sulfanylpropyl]carbamimidoyl]carbamate (PubChem CID 173303591) has the molecular formula C17H24N6O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[N'-[1-[[(3S)-pyrrolidine-3-carbonyl]amino]-1-sulfanylpropyl]carbamimidoyl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[N'-[1-[[(3S)-pyrrolidine-3-carbonyl]amino]-1-sulfanylpropyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 173303591 |
| Molecular Formula | C17H24N6O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (4-nitrophenyl)methyl N-[N'-[1-[[(3S)-pyrrolidine-3-carbonyl]amino]-1-sulfanylpropyl]carbamimidoyl]carbamate |
| SMILES | CCC(S)(N=C(N)NC(=O)OCc1ccc([N+](=O)[O-])cc1)NC(=O)[C@H]1CCNC1 |
| InChI | InChI=1S/C17H24N6O5S/c1-2-17(29,21-14(24)12-7-8-19-9-12)22-15(18)20-16(25)28-10-11-3-5-13(6-4-11)23(26)27/h3-6,12,19,29H,2,7-10H2,1H3,(H,21,24)(H3,18,20,22,25)/t12-,17?/m0/s1 |
| InChIKey | AFAUYTVIAYZLMI-WHUIICBVSA-N |
| XLogP | 0.86 |
| TPSA | 160.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|