C23H25N7O9 — CID 18699737
(4-nitrophenyl)methyl N-[N'-[3-(azetidin-3-ylamino)-3-oxopropyl]-N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]carbamate (PubChem CID 18699737) has the molecular formula C23H25N7O9 and a molecular weight of 543.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[N'-[3-(azetidin-3-ylamino)-3-oxopropyl]-N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[N'-[3-(azetidin-3-ylamino)-3-oxopropyl]-N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 18699737 |
| Molecular Formula | C23H25N7O9 |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | (4-nitrophenyl)methyl N-[N'-[3-(azetidin-3-ylamino)-3-oxopropyl]-N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]carbamate |
| SMILES | O=C(CCN=C(NC(=O)OCc1ccc([N+](=O)[O-])cc1)NC(=O)OCc1ccc([N+](=O)[O-])cc1)NC1CNC1 |
| InChI | InChI=1S/C23H25N7O9/c31-20(26-17-11-24-12-17)9-10-25-21(27-22(32)38-13-15-1-5-18(6-2-15)29(34)35)28-23(33)39-14-16-3-7-19(8-4-16)30(36)37/h1-8,17,24H,9-14H2,(H,26,31)(H2,25,27,28,32,33) |
| InChIKey | ZXQGOIRKWSPFAB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 216.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|