C23H25N7O9 — CID 73457552
(4-nitrophenyl)methyl N-[[[2-(azetidin-3-ylamino)-2-oxoethyl]-methylamino]-[(4-nitrophenyl)methoxycarbonylamino]methylidene]carbamate (PubChem CID 73457552) has the molecular formula C23H25N7O9 and a molecular weight of 543.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[[[2-(azetidin-3-ylamino)-2-oxoethyl]-methylamino]-[(4-nitrophenyl)methoxycarbonylamino]methylidene]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[[[2-(azetidin-3-ylamino)-2-oxoethyl]-methylamino]-[(4-nitrophenyl)methoxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 73457552 |
| Molecular Formula | C23H25N7O9 |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | (4-nitrophenyl)methyl N-[[[2-(azetidin-3-ylamino)-2-oxoethyl]-methylamino]-[(4-nitrophenyl)methoxycarbonylamino]methylidene]carbamate |
| SMILES | CN(CC(=O)NC1CNC1)C(=NC(=O)OCc1ccc([N+](=O)[O-])cc1)NC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H25N7O9/c1-28(12-20(31)25-17-10-24-11-17)21(26-22(32)38-13-15-2-6-18(7-3-15)29(34)35)27-23(33)39-14-16-4-8-19(9-5-16)30(36)37/h2-9,17,24H,10-14H2,1H3,(H,25,31)(H,26,27,32,33) |
| InChIKey | YFDCDJLTWBXBOQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 207.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|