C22H21N5O9 — CID 172837282
(4-nitrophenyl)methyl N-[[(4-nitrophenyl)methoxycarbonylamino]-(4-oxopiperidin-1-yl)methylidene]carbamate (PubChem CID 172837282) has the molecular formula C22H21N5O9 and a molecular weight of 499.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[[(4-nitrophenyl)methoxycarbonylamino]-(4-oxopiperidin-1-yl)methylidene]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[[(4-nitrophenyl)methoxycarbonylamino]-(4-oxopiperidin-1-yl)methylidene]carbamate |
|---|---|
| PubChem CID | 172837282 |
| Molecular Formula | C22H21N5O9 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | (4-nitrophenyl)methyl N-[[(4-nitrophenyl)methoxycarbonylamino]-(4-oxopiperidin-1-yl)methylidene]carbamate |
| SMILES | O=C1CCN(C(=NC(=O)OCc2ccc([N+](=O)[O-])cc2)NC(=O)OCc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C22H21N5O9/c28-19-9-11-25(12-10-19)20(23-21(29)35-13-15-1-5-17(6-2-15)26(31)32)24-22(30)36-14-16-3-7-18(8-4-16)27(33)34/h1-8H,9-14H2,(H,23,24,29,30) |
| InChIKey | WHZMOLOGYRCLDS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 183.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|