C23H25N3O6 — CID 10741700
1-[(Z)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidine-3-carboxylic acid (PubChem CID 10741700) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is 1-[(Z)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(Z)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 10741700 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1-[(Z)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(/N=C(/NC(=O)OCc1ccccc1)N1CCCC(C(=O)O)C1)OCc1ccccc1 |
| InChI | InChI=1S/C23H25N3O6/c27-20(28)19-12-7-13-26(14-19)21(24-22(29)31-15-17-8-3-1-4-9-17)25-23(30)32-16-18-10-5-2-6-11-18/h1-6,8-11,19H,7,12-16H2,(H,27,28)(H,24,25,29,30) |
| InChIKey | HSKQYQNBVFLQTN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|