C36H43N5O7 — CID 68540477
tert-butyl N-[(2S)-1-[[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-4-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 68540477) has the molecular formula C36H43N5O7 and a molecular weight of 657.77 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-4-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-4-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 68540477 |
| Molecular Formula | C36H43N5O7 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-4-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)NC1CCN(C(=NC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C36H43N5O7/c1-36(2,3)48-35(45)38-30(23-26-13-7-4-8-14-26)31(42)37-29-19-21-41(22-20-29)32(39-33(43)46-24-27-15-9-5-10-16-27)40-34(44)47-25-28-17-11-6-12-18-28/h4-18,29-30H,19-25H2,1-3H3,(H,37,42)(H,38,45)(H,39,40,43,44)/t30-/m0/s1 |
| InChIKey | OSXVZGFGHRNVIZ-PMERELPUSA-N |
| XLogP | 5.32 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|