C37H54N6O8 — CID 157352337
tert-butyl N-[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-4-yl]carbamate;tert-butyl N-piperidin-4-ylcarbamate (PubChem CID 157352337) has the molecular formula C37H54N6O8 and a molecular weight of 710.87 g/mol. Its IUPAC name is tert-butyl N-[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-4-yl]carbamate;tert-butyl N-piperidin-4-ylcarbamate.
| Compound Name | tert-butyl N-[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-4-yl]carbamate;tert-butyl N-piperidin-4-ylcarbamate |
|---|---|
| PubChem CID | 157352337 |
| Molecular Formula | C37H54N6O8 |
| Molecular Weight | 710.87 g/mol |
| Exact Mass | 710.40 |
| IUPAC Name | tert-butyl N-[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-4-yl]carbamate;tert-butyl N-piperidin-4-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=NC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)CC1.CC(C)(C)OC(=O)NC1CCNCC1 |
| InChI | InChI=1S/C27H34N4O6.C10H20N2O2/c1-27(2,3)37-26(34)28-22-14-16-31(17-15-22)23(29-24(32)35-18-20-10-6-4-7-11-20)30-25(33)36-19-21-12-8-5-9-13-21;1-10(2,3)14-9(13)12-8-4-6-11-7-5-8/h4-13,22H,14-19H2,1-3H3,(H,28,34)(H,29,30,32,33);8,11H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | BHRLDLBXZTTWAU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 168.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.87 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|