C40H45N5O8 — CID 91243861
benzyl (3R)-3-[[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-3-yl]methyl]-4-oxo-1-(piperidine-1-carbonyl)azetidine-2-carboxylate (PubChem CID 91243861) has the molecular formula C40H45N5O8 and a molecular weight of 723.83 g/mol. Its IUPAC name is benzyl (3R)-3-[[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-3-yl]methyl]-4-oxo-1-(piperidine-1-carbonyl)azetidine-2-carboxylate.
| Compound Name | benzyl (3R)-3-[[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-3-yl]methyl]-4-oxo-1-(piperidine-1-carbonyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 91243861 |
| Molecular Formula | C40H45N5O8 |
| Molecular Weight | 723.83 g/mol |
| Exact Mass | 723.33 |
| IUPAC Name | benzyl (3R)-3-[[1-[N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-3-yl]methyl]-4-oxo-1-(piperidine-1-carbonyl)azetidine-2-carboxylate |
| SMILES | O=C(N=C(NC(=O)OCc1ccccc1)N1CCCC(C[C@H]2C(=O)N(C(=O)N3CCCCC3)C2C(=O)OCc2ccccc2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C40H45N5O8/c46-35-33(34(36(47)51-26-29-14-5-1-6-15-29)45(35)40(50)43-21-11-4-12-22-43)24-32-20-13-23-44(25-32)37(41-38(48)52-27-30-16-7-2-8-17-30)42-39(49)53-28-31-18-9-3-10-19-31/h1-3,5-10,14-19,32-34H,4,11-13,20-28H2,(H,41,42,48,49)/t32?,33-,34?/m1/s1 |
| InChIKey | DDNQVKWGGGNGHJ-QVGGVDQBSA-N |
| XLogP | 5.88 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.83 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|