C36H39N5O8 — CID 20716009
benzyl 3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-1-(3-methylazetidine-1-carbonyl)-4-oxoazetidine-2-carboxylate (PubChem CID 20716009) has the molecular formula C36H39N5O8 and a molecular weight of 669.74 g/mol. Its IUPAC name is benzyl 3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-1-(3-methylazetidine-1-carbonyl)-4-oxoazetidine-2-carboxylate.
| Compound Name | benzyl 3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-1-(3-methylazetidine-1-carbonyl)-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 20716009 |
| Molecular Formula | C36H39N5O8 |
| Molecular Weight | 669.74 g/mol |
| Exact Mass | 669.28 |
| IUPAC Name | benzyl 3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-1-(3-methylazetidine-1-carbonyl)-4-oxoazetidine-2-carboxylate |
| SMILES | CC1CN(C(=O)N2C(=O)C(CCCN=C(NC(=O)OCc3ccccc3)NC(=O)OCc3ccccc3)C2C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C36H39N5O8/c1-25-20-40(21-25)36(46)41-30(32(43)47-22-26-12-5-2-6-13-26)29(31(41)42)18-11-19-37-33(38-34(44)48-23-27-14-7-3-8-15-27)39-35(45)49-24-28-16-9-4-10-17-28/h2-10,12-17,25,29-30H,11,18-24H2,1H3,(H2,37,38,39,44,45) |
| InChIKey | PRUUHBAQSSNTEO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 155.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.74 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|