C27H30N4O8 — CID 70069630
methyl (2R,3S)-1-acetyl-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylate (PubChem CID 70069630) has the molecular formula C27H30N4O8 and a molecular weight of 538.56 g/mol. Its IUPAC name is methyl (2R,3S)-1-acetyl-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylate.
| Compound Name | methyl (2R,3S)-1-acetyl-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 70069630 |
| Molecular Formula | C27H30N4O8 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | methyl (2R,3S)-1-acetyl-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](CCCN=C(NC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)C(=O)N1C(C)=O |
| InChI | InChI=1S/C27H30N4O8/c1-18(32)31-22(24(34)37-2)21(23(31)33)14-9-15-28-25(29-26(35)38-16-19-10-5-3-6-11-19)30-27(36)39-17-20-12-7-4-8-13-20/h3-8,10-13,21-22H,9,14-17H2,1-2H3,(H2,28,29,30,35,36)/t21-,22+/m0/s1 |
| InChIKey | AQDROWOXMCRUFX-FCHUYYIVSA-N |
| XLogP | 2.52 |
| TPSA | 152.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|