C46H52N6O8 — CID 59869904
3-phenylpropyl 4-[(3R,4R)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-2-oxo-4-(2-phenylethyl)azetidine-1-carbonyl]piperazine-1-carboxylate (PubChem CID 59869904) has the molecular formula C46H52N6O8 and a molecular weight of 816.96 g/mol. Its IUPAC name is 3-phenylpropyl 4-[(3R,4R)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-2-oxo-4-(2-phenylethyl)azetidine-1-carbonyl]piperazine-1-carboxylate.
| Compound Name | 3-phenylpropyl 4-[(3R,4R)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-2-oxo-4-(2-phenylethyl)azetidine-1-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59869904 |
| Molecular Formula | C46H52N6O8 |
| Molecular Weight | 816.96 g/mol |
| Exact Mass | 816.38 |
| IUPAC Name | 3-phenylpropyl 4-[(3R,4R)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-2-oxo-4-(2-phenylethyl)azetidine-1-carbonyl]piperazine-1-carboxylate |
| SMILES | O=C(NC(=NCCC[C@H]1C(=O)N(C(=O)N2CCN(C(=O)OCCCc3ccccc3)CC2)[C@@H]1CCc1ccccc1)NC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C46H52N6O8/c53-41-39(24-13-27-47-42(48-43(54)59-33-37-19-9-3-10-20-37)49-44(55)60-34-38-21-11-4-12-22-38)40(26-25-36-17-7-2-8-18-36)52(41)45(56)50-28-30-51(31-29-50)46(57)58-32-14-23-35-15-5-1-6-16-35/h1-12,15-22,39-40H,13-14,23-34H2,(H2,47,48,49,54,55)/t39-,40-/m1/s1 |
| InChIKey | KLKLRDXETZRDIK-XRSDMRJBSA-N |
| XLogP | 6.94 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.96 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|