C44H47N5O8 — CID 59869830
benzyl (3R)-1-(4-benzylpiperidine-1-carbonyl)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylate (PubChem CID 59869830) has the molecular formula C44H47N5O8 and a molecular weight of 773.89 g/mol. Its IUPAC name is benzyl (3R)-1-(4-benzylpiperidine-1-carbonyl)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylate.
| Compound Name | benzyl (3R)-1-(4-benzylpiperidine-1-carbonyl)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 59869830 |
| Molecular Formula | C44H47N5O8 |
| Molecular Weight | 773.89 g/mol |
| Exact Mass | 773.34 |
| IUPAC Name | benzyl (3R)-1-(4-benzylpiperidine-1-carbonyl)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylate |
| SMILES | O=C(NC(=NCCC[C@H]1C(=O)N(C(=O)N2CCC(Cc3ccccc3)CC2)C1C(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C44H47N5O8/c50-39-37(22-13-25-45-41(46-42(52)56-30-35-18-9-3-10-19-35)47-43(53)57-31-36-20-11-4-12-21-36)38(40(51)55-29-34-16-7-2-8-17-34)49(39)44(54)48-26-23-33(24-27-48)28-32-14-5-1-6-15-32/h1-12,14-21,33,37-38H,13,22-31H2,(H2,45,46,47,52,53)/t37-,38?/m1/s1 |
| InChIKey | XALPOSSCEJKRSV-MLPLAHBKSA-N |
| XLogP | 6.62 |
| TPSA | 155.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.89 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|