C39H47N7O8 — CID 59869926
benzyl (3R)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-1-[4-[(dimethylamino)methyl]piperazine-1-carbonyl]-4-oxoazetidine-2-carboxylate (PubChem CID 59869926) has the molecular formula C39H47N7O8 and a molecular weight of 741.85 g/mol. Its IUPAC name is benzyl (3R)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-1-[4-[(dimethylamino)methyl]piperazine-1-carbonyl]-4-oxoazetidine-2-carboxylate.
| Compound Name | benzyl (3R)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-1-[4-[(dimethylamino)methyl]piperazine-1-carbonyl]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 59869926 |
| Molecular Formula | C39H47N7O8 |
| Molecular Weight | 741.85 g/mol |
| Exact Mass | 741.35 |
| IUPAC Name | benzyl (3R)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-1-[4-[(dimethylamino)methyl]piperazine-1-carbonyl]-4-oxoazetidine-2-carboxylate |
| SMILES | CN(C)CN1CCN(C(=O)N2C(=O)[C@H](CCCN=C(NC(=O)OCc3ccccc3)NC(=O)OCc3ccccc3)C2C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C39H47N7O8/c1-43(2)28-44-21-23-45(24-22-44)39(51)46-33(35(48)52-25-29-13-6-3-7-14-29)32(34(46)47)19-12-20-40-36(41-37(49)53-26-30-15-8-4-9-16-30)42-38(50)54-27-31-17-10-5-11-18-31/h3-11,13-18,32-33H,12,19-28H2,1-2H3,(H2,40,41,42,49,50)/t32-,33?/m1/s1 |
| InChIKey | OJBVRZLHUMYXDC-KWRHIPAJSA-N |
| XLogP | 3.80 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.85 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|