C25H32N4O7 — CID 143306536
(3S)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]azetidine-2-carboxylic acid;methanol (PubChem CID 143306536) has the molecular formula C25H32N4O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is (3S)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]azetidine-2-carboxylic acid;methanol.
| Compound Name | (3S)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]azetidine-2-carboxylic acid;methanol |
|---|---|
| PubChem CID | 143306536 |
| Molecular Formula | C25H32N4O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (3S)-3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]azetidine-2-carboxylic acid;methanol |
| SMILES | CO.O=C(NC(=NCCC[C@H]1CNC1C(=O)O)NC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H28N4O6.CH4O/c29-21(30)20-19(14-26-20)12-7-13-25-22(27-23(31)33-15-17-8-3-1-4-9-17)28-24(32)34-16-18-10-5-2-6-11-18;1-2/h1-6,8-11,19-20,26H,7,12-16H2,(H,29,30)(H2,25,27,28,31,32);2H,1H3/t19-,20?;/m0./s1 |
| InChIKey | APGWBHVKGFYVMI-CQLADDOKSA-N |
| XLogP | 2.26 |
| TPSA | 158.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|