C22H29N5O6S — CID 10577049
benzyl N-[N'-[(4S)-4-amino-5-sulfamoylpentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate (PubChem CID 10577049) has the molecular formula C22H29N5O6S and a molecular weight of 491.57 g/mol. Its IUPAC name is benzyl N-[N'-[(4S)-4-amino-5-sulfamoylpentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | benzyl N-[N'-[(4S)-4-amino-5-sulfamoylpentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 10577049 |
| Molecular Formula | C22H29N5O6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | benzyl N-[N'-[(4S)-4-amino-5-sulfamoylpentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
| SMILES | N[C@@H](CCCN=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)CS(N)(=O)=O |
| InChI | InChI=1S/C22H29N5O6S/c23-19(16-34(24,30)31)12-7-13-25-20(26-21(28)32-14-17-8-3-1-4-9-17)27-22(29)33-15-18-10-5-2-6-11-18/h1-6,8-11,19H,7,12-16,23H2,(H2,24,30,31)(H2,25,26,27,28,29)/t19-/m0/s1 |
| InChIKey | TXZNBUUIXSVJHM-IBGZPJMESA-N |
| XLogP | 1.59 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|