C36H50N6O8 — CID 11136225
benzyl N-[N'-[(4S)-4-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate (PubChem CID 11136225) has the molecular formula C36H50N6O8 and a molecular weight of 694.83 g/mol. Its IUPAC name is benzyl N-[N'-[(4S)-4-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | benzyl N-[N'-[(4S)-4-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 11136225 |
| Molecular Formula | C36H50N6O8 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.37 |
| IUPAC Name | benzyl N-[N'-[(4S)-4-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)CCCN=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H50N6O8/c1-24(2)19-30(38-26(5)44)33(46)40-31(20-25(3)4)32(45)39-29(21-43)17-12-18-37-34(41-35(47)49-22-27-13-8-6-9-14-27)42-36(48)50-23-28-15-10-7-11-16-28/h6-11,13-16,21,24-25,29-31H,12,17-20,22-23H2,1-5H3,(H,38,44)(H,39,45)(H,40,46)(H2,37,41,42,47,48)/t29-,30-,31-/m0/s1 |
| InChIKey | UCFIJJMHOGWEKK-CHQNGUEUSA-N |
| XLogP | 3.74 |
| TPSA | 193.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|