C36H54N8O6 — CID 59254232
benzyl N-[1-[[1-[[1-[(2-acetamido-3-phenylpropanoyl)amino]-3-methylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate (PubChem CID 59254232) has the molecular formula C36H54N8O6 and a molecular weight of 694.88 g/mol. Its IUPAC name is benzyl N-[1-[[1-[[1-[(2-acetamido-3-phenylpropanoyl)amino]-3-methylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[1-[[1-[(2-acetamido-3-phenylpropanoyl)amino]-3-methylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 59254232 |
| Molecular Formula | C36H54N8O6 |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.42 |
| IUPAC Name | benzyl N-[1-[[1-[[1-[(2-acetamido-3-phenylpropanoyl)amino]-3-methylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)NCC(NC(=O)C(CC(C)C)NC(=O)C(CCCN=C(N)N)NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C36H54N8O6/c1-23(2)19-29(42-33(47)28(17-12-18-39-35(37)38)44-36(49)50-22-27-15-10-7-11-16-27)34(48)43-31(24(3)4)21-40-32(46)30(41-25(5)45)20-26-13-8-6-9-14-26/h6-11,13-16,23-24,28-31H,12,17-22H2,1-5H3,(H,40,46)(H,41,45)(H,42,47)(H,43,48)(H,44,49)(H4,37,38,39) |
| InChIKey | ZJVYLYTWOKCYCN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 219.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|