C30H43N5O4S — CID 11410518
benzyl N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-2-oxo-1-(3-phenylpropylsulfanyl)hexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 11410518) has the molecular formula C30H43N5O4S and a molecular weight of 569.77 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-2-oxo-1-(3-phenylpropylsulfanyl)hexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-2-oxo-1-(3-phenylpropylsulfanyl)hexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 11410518 |
| Molecular Formula | C30H43N5O4S |
| Molecular Weight | 569.77 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | benzyl N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-2-oxo-1-(3-phenylpropylsulfanyl)hexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)CSCCCc1ccccc1 |
| InChI | InChI=1S/C30H43N5O4S/c1-22(2)19-26(35-30(38)39-20-24-13-7-4-8-14-24)28(37)34-25(16-9-17-33-29(31)32)27(36)21-40-18-10-15-23-11-5-3-6-12-23/h3-8,11-14,22,25-26H,9-10,15-21H2,1-2H3,(H,34,37)(H,35,38)(H4,31,32,33)/t25-,26-/m0/s1 |
| InChIKey | NXERXIRFEPHVEC-UIOOFZCWSA-N |
| XLogP | 3.80 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|