C29H40N6O5 — CID 175756146
benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 175756146) has the molecular formula C29H40N6O5 and a molecular weight of 552.68 g/mol. Its IUPAC name is benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 175756146 |
| Molecular Formula | C29H40N6O5 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H40N6O5/c1-20(2)16-25(27(38)33-23(18-36)17-21-10-5-3-6-11-21)34-26(37)24(14-9-15-32-28(30)31)35-29(39)40-19-22-12-7-4-8-13-22/h3-8,10-13,18,20,23-25H,9,14-17,19H2,1-2H3,(H,33,38)(H,34,37)(H,35,39)(H4,30,31,32)/t23-,24-,25-/m0/s1 |
| InChIKey | RQGYDNPBDPYGSJ-SDHOMARFSA-N |
| XLogP | 1.79 |
| TPSA | 178.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|