C29H40N4O5 — CID 14488967
benzyl N-[1-[[1-[(6-amino-1-oxohexan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 14488967) has the molecular formula C29H40N4O5 and a molecular weight of 524.66 g/mol. Its IUPAC name is benzyl N-[1-[[1-[(6-amino-1-oxohexan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[1-[(6-amino-1-oxohexan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 14488967 |
| Molecular Formula | C29H40N4O5 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | benzyl N-[1-[[1-[(6-amino-1-oxohexan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)NC(C=O)CCCCN |
| InChI | InChI=1S/C29H40N4O5/c1-21(2)17-25(27(35)31-24(19-34)15-9-10-16-30)32-28(36)26(18-22-11-5-3-6-12-22)33-29(37)38-20-23-13-7-4-8-14-23/h3-8,11-14,19,21,24-26H,9-10,15-18,20,30H2,1-2H3,(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | NBWOGVRHTNQEQI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|