C31H42N4O8 — CID 175819021
methyl (3S)-3-[[(2S)-6-amino-2-[[(2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoyl]amino]-5-methyl-2-oxohexanoate (PubChem CID 175819021) has the molecular formula C31H42N4O8 and a molecular weight of 598.70 g/mol. Its IUPAC name is methyl (3S)-3-[[(2S)-6-amino-2-[[(2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoyl]amino]-5-methyl-2-oxohexanoate.
| Compound Name | methyl (3S)-3-[[(2S)-6-amino-2-[[(2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoyl]amino]-5-methyl-2-oxohexanoate |
|---|---|
| PubChem CID | 175819021 |
| Molecular Formula | C31H42N4O8 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | methyl (3S)-3-[[(2S)-6-amino-2-[[(2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoyl]amino]-5-methyl-2-oxohexanoate |
| SMILES | COC(=O)C(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H42N4O8/c1-20(2)17-25(27(37)30(40)42-3)34-28(38)24(11-7-8-16-32)33-29(39)26(18-21-12-14-23(36)15-13-21)35-31(41)43-19-22-9-5-4-6-10-22/h4-6,9-10,12-15,20,24-26,36H,7-8,11,16-19,32H2,1-3H3,(H,33,39)(H,34,38)(H,35,41)/t24-,25-,26-/m0/s1 |
| InChIKey | RLXRVGVELOLTJF-GSDHBNRESA-N |
| XLogP | 2.12 |
| TPSA | 186.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|